C30H29F2N3O2 — CID 42667216
(4-benzylpiperazin-1-yl)-[1-[(2,6-difluorophenyl)methyl]-4-prop-2-enoxyindol-2-yl]methanone (PubChem CID 42667216) has the molecular formula C30H29F2N3O2 and a molecular weight of 501.58 g/mol. Its IUPAC name is (4-benzylpiperazin-1-yl)-[1-[(2,6-difluorophenyl)methyl]-4-prop-2-enoxyindol-2-yl]methanone.
| Compound Name | (4-benzylpiperazin-1-yl)-[1-[(2,6-difluorophenyl)methyl]-4-prop-2-enoxyindol-2-yl]methanone |
|---|---|
| PubChem CID | 42667216 |
| Molecular Formula | C30H29F2N3O2 |
| Molecular Weight | 501.58 g/mol |
| Exact Mass | 501.22 |
| IUPAC Name | (4-benzylpiperazin-1-yl)-[1-[(2,6-difluorophenyl)methyl]-4-prop-2-enoxyindol-2-yl]methanone |
| SMILES | C=CCOc1cccc2c1cc(C(=O)N1CCN(Cc3ccccc3)CC1)n2Cc1c(F)cccc1F |
| InChI | InChI=1S/C30H29F2N3O2/c1-2-18-37-29-13-7-12-27-23(29)19-28(35(27)21-24-25(31)10-6-11-26(24)32)30(36)34-16-14-33(15-17-34)20-22-8-4-3-5-9-22/h2-13,19H,1,14-18,20-21H2 |
| InChIKey | TUBMSPZGAHRUHT-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 37.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.58 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|