C31H35N3O2 — CID 93123879
[1-benzyl-4-[(2R)-butan-2-yl]oxyindol-2-yl]-(4-benzylpiperazin-1-yl)methanone (PubChem CID 93123879) has the molecular formula C31H35N3O2 and a molecular weight of 481.64 g/mol. Its IUPAC name is [1-benzyl-4-[(2R)-butan-2-yl]oxyindol-2-yl]-(4-benzylpiperazin-1-yl)methanone.
| Compound Name | [1-benzyl-4-[(2R)-butan-2-yl]oxyindol-2-yl]-(4-benzylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 93123879 |
| Molecular Formula | C31H35N3O2 |
| Molecular Weight | 481.64 g/mol |
| Exact Mass | 481.27 |
| IUPAC Name | [1-benzyl-4-[(2R)-butan-2-yl]oxyindol-2-yl]-(4-benzylpiperazin-1-yl)methanone |
| SMILES | CC[C@@H](C)Oc1cccc2c1cc(C(=O)N1CCN(Cc3ccccc3)CC1)n2Cc1ccccc1 |
| InChI | InChI=1S/C31H35N3O2/c1-3-24(2)36-30-16-10-15-28-27(30)21-29(34(28)23-26-13-8-5-9-14-26)31(35)33-19-17-32(18-20-33)22-25-11-6-4-7-12-25/h4-16,21,24H,3,17-20,22-23H2,1-2H3/t24-/m1/s1 |
| InChIKey | ZAADBDYQTLHLRV-XMMPIXPASA-N |
| XLogP | 5.82 |
| TPSA | 37.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.64 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |