C31H35N3O3 — CID 42666992
(1-benzyl-4-butan-2-yloxyindol-2-yl)-[4-(2-methoxyphenyl)piperazin-1-yl]methanone (PubChem CID 42666992) has the molecular formula C31H35N3O3 and a molecular weight of 497.64 g/mol. Its IUPAC name is (1-benzyl-4-butan-2-yloxyindol-2-yl)-[4-(2-methoxyphenyl)piperazin-1-yl]methanone.
| Compound Name | (1-benzyl-4-butan-2-yloxyindol-2-yl)-[4-(2-methoxyphenyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 42666992 |
| Molecular Formula | C31H35N3O3 |
| Molecular Weight | 497.64 g/mol |
| Exact Mass | 497.27 |
| IUPAC Name | (1-benzyl-4-butan-2-yloxyindol-2-yl)-[4-(2-methoxyphenyl)piperazin-1-yl]methanone |
| SMILES | CCC(C)Oc1cccc2c1cc(C(=O)N1CCN(c3ccccc3OC)CC1)n2Cc1ccccc1 |
| InChI | InChI=1S/C31H35N3O3/c1-4-23(2)37-29-16-10-14-26-25(29)21-28(34(26)22-24-11-6-5-7-12-24)31(35)33-19-17-32(18-20-33)27-13-8-9-15-30(27)36-3/h5-16,21,23H,4,17-20,22H2,1-3H3 |
| InChIKey | JPDQTBLZPKVTJV-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 46.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.64 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |