C22H22F2N2O2 — CID 42805833
1-[(2,4-difluorophenyl)methyl]-4-prop-2-enoxy-N-propylindole-2-carboxamide (PubChem CID 42805833) has the molecular formula C22H22F2N2O2 and a molecular weight of 384.43 g/mol. Its IUPAC name is 1-[(2,4-difluorophenyl)methyl]-4-prop-2-enoxy-N-propylindole-2-carboxamide.
| Compound Name | 1-[(2,4-difluorophenyl)methyl]-4-prop-2-enoxy-N-propylindole-2-carboxamide |
|---|---|
| PubChem CID | 42805833 |
| Molecular Formula | C22H22F2N2O2 |
| Molecular Weight | 384.43 g/mol |
| Exact Mass | 384.16 |
| IUPAC Name | 1-[(2,4-difluorophenyl)methyl]-4-prop-2-enoxy-N-propylindole-2-carboxamide |
| SMILES | C=CCOc1cccc2c1cc(C(=O)NCCC)n2Cc1ccc(F)cc1F |
| InChI | InChI=1S/C22H22F2N2O2/c1-3-10-25-22(27)20-13-17-19(6-5-7-21(17)28-11-4-2)26(20)14-15-8-9-16(23)12-18(15)24/h4-9,12-13H,2-3,10-11,14H2,1H3,(H,25,27) |
| InChIKey | UJPFUUMVFWJNGV-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 43.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.43 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|