C25H24N2O3 — CID 42807262
N-(furan-2-ylmethyl)-1-[(2-methylphenyl)methyl]-4-prop-2-enoxyindole-2-carboxamide (PubChem CID 42807262) has the molecular formula C25H24N2O3 and a molecular weight of 400.48 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-1-[(2-methylphenyl)methyl]-4-prop-2-enoxyindole-2-carboxamide.
| Compound Name | N-(furan-2-ylmethyl)-1-[(2-methylphenyl)methyl]-4-prop-2-enoxyindole-2-carboxamide |
|---|---|
| PubChem CID | 42807262 |
| Molecular Formula | C25H24N2O3 |
| Molecular Weight | 400.48 g/mol |
| Exact Mass | 400.18 |
| IUPAC Name | N-(furan-2-ylmethyl)-1-[(2-methylphenyl)methyl]-4-prop-2-enoxyindole-2-carboxamide |
| SMILES | C=CCOc1cccc2c1cc(C(=O)NCc1ccco1)n2Cc1ccccc1C |
| InChI | InChI=1S/C25H24N2O3/c1-3-13-30-24-12-6-11-22-21(24)15-23(25(28)26-16-20-10-7-14-29-20)27(22)17-19-9-5-4-8-18(19)2/h3-12,14-15H,1,13,16-17H2,2H3,(H,26,28) |
| InChIKey | DURNUMRXYXFZMK-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 56.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.48 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|