C27H24F3N3O2 — CID 42667040
4-prop-2-enoxy-N-(2-pyridin-2-ylethyl)-1-[[4-(trifluoromethyl)phenyl]methyl]indole-2-carboxamide (PubChem CID 42667040) has the molecular formula C27H24F3N3O2 and a molecular weight of 479.50 g/mol. Its IUPAC name is 4-prop-2-enoxy-N-(2-pyridin-2-ylethyl)-1-[[4-(trifluoromethyl)phenyl]methyl]indole-2-carboxamide.
| Compound Name | 4-prop-2-enoxy-N-(2-pyridin-2-ylethyl)-1-[[4-(trifluoromethyl)phenyl]methyl]indole-2-carboxamide |
|---|---|
| PubChem CID | 42667040 |
| Molecular Formula | C27H24F3N3O2 |
| Molecular Weight | 479.50 g/mol |
| Exact Mass | 479.18 |
| IUPAC Name | 4-prop-2-enoxy-N-(2-pyridin-2-ylethyl)-1-[[4-(trifluoromethyl)phenyl]methyl]indole-2-carboxamide |
| SMILES | C=CCOc1cccc2c1cc(C(=O)NCCc1ccccn1)n2Cc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C27H24F3N3O2/c1-2-16-35-25-8-5-7-23-22(25)17-24(26(34)32-15-13-21-6-3-4-14-31-21)33(23)18-19-9-11-20(12-10-19)27(28,29)30/h2-12,14,17H,1,13,15-16,18H2,(H,32,34) |
| InChIKey | VKEGGXGFZMHYGO-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.50 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|