C26H21F3N2O2 — CID 42807293
1-[(3,4-difluorophenyl)methyl]-N-[(4-fluorophenyl)methyl]-4-prop-2-enoxyindole-2-carboxamide (PubChem CID 42807293) has the molecular formula C26H21F3N2O2 and a molecular weight of 450.46 g/mol. Its IUPAC name is 1-[(3,4-difluorophenyl)methyl]-N-[(4-fluorophenyl)methyl]-4-prop-2-enoxyindole-2-carboxamide.
| Compound Name | 1-[(3,4-difluorophenyl)methyl]-N-[(4-fluorophenyl)methyl]-4-prop-2-enoxyindole-2-carboxamide |
|---|---|
| PubChem CID | 42807293 |
| Molecular Formula | C26H21F3N2O2 |
| Molecular Weight | 450.46 g/mol |
| Exact Mass | 450.16 |
| IUPAC Name | 1-[(3,4-difluorophenyl)methyl]-N-[(4-fluorophenyl)methyl]-4-prop-2-enoxyindole-2-carboxamide |
| SMILES | C=CCOc1cccc2c1cc(C(=O)NCc1ccc(F)cc1)n2Cc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C26H21F3N2O2/c1-2-12-33-25-5-3-4-23-20(25)14-24(26(32)30-15-17-6-9-19(27)10-7-17)31(23)16-18-8-11-21(28)22(29)13-18/h2-11,13-14H,1,12,15-16H2,(H,30,32) |
| InChIKey | FNFFRHVNLYQDFO-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 43.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.46 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|