C23H22F2N2O2 — CID 42667209
[1-[(2,6-difluorophenyl)methyl]-4-prop-2-enoxyindol-2-yl]-pyrrolidin-1-ylmethanone (PubChem CID 42667209) has the molecular formula C23H22F2N2O2 and a molecular weight of 396.44 g/mol. Its IUPAC name is [1-[(2,6-difluorophenyl)methyl]-4-prop-2-enoxyindol-2-yl]-pyrrolidin-1-ylmethanone.
| Compound Name | [1-[(2,6-difluorophenyl)methyl]-4-prop-2-enoxyindol-2-yl]-pyrrolidin-1-ylmethanone |
|---|---|
| PubChem CID | 42667209 |
| Molecular Formula | C23H22F2N2O2 |
| Molecular Weight | 396.44 g/mol |
| Exact Mass | 396.16 |
| IUPAC Name | [1-[(2,6-difluorophenyl)methyl]-4-prop-2-enoxyindol-2-yl]-pyrrolidin-1-ylmethanone |
| SMILES | C=CCOc1cccc2c1cc(C(=O)N1CCCC1)n2Cc1c(F)cccc1F |
| InChI | InChI=1S/C23H22F2N2O2/c1-2-13-29-22-10-6-9-20-16(22)14-21(23(28)26-11-3-4-12-26)27(20)15-17-18(24)7-5-8-19(17)25/h2,5-10,14H,1,3-4,11-13,15H2 |
| InChIKey | MRODMRICEYJEEI-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 34.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.44 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|