C24H30N2O4 — CID 71958234
ethyl 1-(1-but-2-enyl-4-prop-2-enoxyindole-2-carbonyl)piperidine-4-carboxylate (PubChem CID 71958234) has the molecular formula C24H30N2O4 and a molecular weight of 410.51 g/mol. Its IUPAC name is ethyl 1-(1-but-2-enyl-4-prop-2-enoxyindole-2-carbonyl)piperidine-4-carboxylate.
| Compound Name | ethyl 1-(1-but-2-enyl-4-prop-2-enoxyindole-2-carbonyl)piperidine-4-carboxylate |
|---|---|
| PubChem CID | 71958234 |
| Molecular Formula | C24H30N2O4 |
| Molecular Weight | 410.51 g/mol |
| Exact Mass | 410.22 |
| IUPAC Name | ethyl 1-(1-but-2-enyl-4-prop-2-enoxyindole-2-carbonyl)piperidine-4-carboxylate |
| SMILES | C=CCOc1cccc2c1cc(C(=O)N1CCC(C(=O)OCC)CC1)n2CC=CC |
| InChI | InChI=1S/C24H30N2O4/c1-4-7-13-26-20-9-8-10-22(30-16-5-2)19(20)17-21(26)23(27)25-14-11-18(12-15-25)24(28)29-6-3/h4-5,7-10,17-18H,2,6,11-16H2,1,3H3 |
| InChIKey | MJYVKAOPCHCTLF-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 60.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.51 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|