C25H27F2N3O2 — CID 42667233
[1-[(2,5-difluorophenyl)methyl]-4-prop-2-enoxyindol-2-yl]-(4-ethylpiperazin-1-yl)methanone (PubChem CID 42667233) has the molecular formula C25H27F2N3O2 and a molecular weight of 439.51 g/mol. Its IUPAC name is [1-[(2,5-difluorophenyl)methyl]-4-prop-2-enoxyindol-2-yl]-(4-ethylpiperazin-1-yl)methanone.
| Compound Name | [1-[(2,5-difluorophenyl)methyl]-4-prop-2-enoxyindol-2-yl]-(4-ethylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 42667233 |
| Molecular Formula | C25H27F2N3O2 |
| Molecular Weight | 439.51 g/mol |
| Exact Mass | 439.21 |
| IUPAC Name | [1-[(2,5-difluorophenyl)methyl]-4-prop-2-enoxyindol-2-yl]-(4-ethylpiperazin-1-yl)methanone |
| SMILES | C=CCOc1cccc2c1cc(C(=O)N1CCN(CC)CC1)n2Cc1cc(F)ccc1F |
| InChI | InChI=1S/C25H27F2N3O2/c1-3-14-32-24-7-5-6-22-20(24)16-23(25(31)29-12-10-28(4-2)11-13-29)30(22)17-18-15-19(26)8-9-21(18)27/h3,5-9,15-16H,1,4,10-14,17H2,2H3 |
| InChIKey | GASQXECRXFMWRR-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 37.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.51 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|