C26H31N3O2 — CID 42807246
1-[(4-methylphenyl)methyl]-4-prop-2-enoxy-N-(2-pyrrolidin-1-ylethyl)indole-2-carboxamide (PubChem CID 42807246) has the molecular formula C26H31N3O2 and a molecular weight of 417.55 g/mol. Its IUPAC name is 1-[(4-methylphenyl)methyl]-4-prop-2-enoxy-N-(2-pyrrolidin-1-ylethyl)indole-2-carboxamide.
| Compound Name | 1-[(4-methylphenyl)methyl]-4-prop-2-enoxy-N-(2-pyrrolidin-1-ylethyl)indole-2-carboxamide |
|---|---|
| PubChem CID | 42807246 |
| Molecular Formula | C26H31N3O2 |
| Molecular Weight | 417.55 g/mol |
| Exact Mass | 417.24 |
| IUPAC Name | 1-[(4-methylphenyl)methyl]-4-prop-2-enoxy-N-(2-pyrrolidin-1-ylethyl)indole-2-carboxamide |
| SMILES | C=CCOc1cccc2c1cc(C(=O)NCCN1CCCC1)n2Cc1ccc(C)cc1 |
| InChI | InChI=1S/C26H31N3O2/c1-3-17-31-25-8-6-7-23-22(25)18-24(26(30)27-13-16-28-14-4-5-15-28)29(23)19-21-11-9-20(2)10-12-21/h3,6-12,18H,1,4-5,13-17,19H2,2H3,(H,27,30) |
| InChIKey | JHLZWFANHGCXOJ-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 46.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.55 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|