C19H19NO3 — CID 42804741
4-ethoxy-1-[(4-methylphenyl)methyl]indole-2-carboxylic acid (PubChem CID 42804741) has the molecular formula C19H19NO3 and a molecular weight of 309.37 g/mol. Its IUPAC name is 4-ethoxy-1-[(4-methylphenyl)methyl]indole-2-carboxylic acid.
| Compound Name | 4-ethoxy-1-[(4-methylphenyl)methyl]indole-2-carboxylic acid |
|---|---|
| PubChem CID | 42804741 |
| Molecular Formula | C19H19NO3 |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.14 |
| IUPAC Name | 4-ethoxy-1-[(4-methylphenyl)methyl]indole-2-carboxylic acid |
| SMILES | CCOc1cccc2c1cc(C(=O)O)n2Cc1ccc(C)cc1 |
| InChI | InChI=1S/C19H19NO3/c1-3-23-18-6-4-5-16-15(18)11-17(19(21)22)20(16)12-14-9-7-13(2)8-10-14/h4-11H,3,12H2,1-2H3,(H,21,22) |
| InChIKey | DOUIDLPKVXDZRT-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 51.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |