C32H24Br2F2N4O2 — CID 160918189
4-bromo-1-[(3-fluorophenyl)methyl]indole-2-carboxamide (PubChem CID 160918189) has the molecular formula C32H24Br2F2N4O2 and a molecular weight of 694.37 g/mol. Its IUPAC name is 4-bromo-1-[(3-fluorophenyl)methyl]indole-2-carboxamide.
| Compound Name | 4-bromo-1-[(3-fluorophenyl)methyl]indole-2-carboxamide |
|---|---|
| PubChem CID | 160918189 |
| Molecular Formula | C32H24Br2F2N4O2 |
| Molecular Weight | 694.37 g/mol |
| Exact Mass | 692.02 |
| IUPAC Name | 4-bromo-1-[(3-fluorophenyl)methyl]indole-2-carboxamide |
| SMILES | NC(=O)c1cc2c(Br)cccc2n1Cc1cccc(F)c1.NC(=O)c1cc2c(Br)cccc2n1Cc1cccc(F)c1 |
| InChI | InChI=1S/2C16H12BrFN2O/c2*17-13-5-2-6-14-12(13)8-15(16(19)21)20(14)9-10-3-1-4-11(18)7-10/h2*1-8H,9H2,(H2,19,21) |
| InChIKey | SRRJUJJZLJRXBF-UHFFFAOYSA-N |
| XLogP | 7.38 |
| TPSA | 96.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.37 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |