C22H24FN3O — CID 24953069
1-[(3-fluorophenyl)methyl]-4-(1-methylpiperidin-4-yl)indole-2-carboxamide (PubChem CID 24953069) has the molecular formula C22H24FN3O and a molecular weight of 365.45 g/mol. Its IUPAC name is 1-[(3-fluorophenyl)methyl]-4-(1-methylpiperidin-4-yl)indole-2-carboxamide.
| Compound Name | 1-[(3-fluorophenyl)methyl]-4-(1-methylpiperidin-4-yl)indole-2-carboxamide |
|---|---|
| PubChem CID | 24953069 |
| Molecular Formula | C22H24FN3O |
| Molecular Weight | 365.45 g/mol |
| Exact Mass | 365.19 |
| IUPAC Name | 1-[(3-fluorophenyl)methyl]-4-(1-methylpiperidin-4-yl)indole-2-carboxamide |
| SMILES | CN1CCC(c2cccc3c2cc(C(N)=O)n3Cc2cccc(F)c2)CC1 |
| InChI | InChI=1S/C22H24FN3O/c1-25-10-8-16(9-11-25)18-6-3-7-20-19(18)13-21(22(24)27)26(20)14-15-4-2-5-17(23)12-15/h2-7,12-13,16H,8-11,14H2,1H3,(H2,24,27) |
| InChIKey | MHDNPXVDUSYGTH-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 51.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.45 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |