C16H11F2NO2 — CID 57431513
5-fluoro-1-[(3-fluorophenyl)methyl]indole-2-carboxylic acid (PubChem CID 57431513) has the molecular formula C16H11F2NO2 and a molecular weight of 287.27 g/mol. Its IUPAC name is 5-fluoro-1-[(3-fluorophenyl)methyl]indole-2-carboxylic acid.
| Compound Name | 5-fluoro-1-[(3-fluorophenyl)methyl]indole-2-carboxylic acid |
|---|---|
| PubChem CID | 57431513 |
| Molecular Formula | C16H11F2NO2 |
| Molecular Weight | 287.27 g/mol |
| Exact Mass | 287.08 |
| IUPAC Name | 5-fluoro-1-[(3-fluorophenyl)methyl]indole-2-carboxylic acid |
| SMILES | O=C(O)c1cc2cc(F)ccc2n1Cc1cccc(F)c1 |
| InChI | InChI=1S/C16H11F2NO2/c17-12-3-1-2-10(6-12)9-19-14-5-4-13(18)7-11(14)8-15(19)16(20)21/h1-8H,9H2,(H,20,21) |
| InChIKey | MPNDQLDEDAQJDE-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.27 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |