C16H11FINO2 — CID 66850442
1-[(3-fluorophenyl)methyl]-5-iodoindole-2-carboxylic acid (PubChem CID 66850442) has the molecular formula C16H11FINO2 and a molecular weight of 395.17 g/mol. Its IUPAC name is 1-[(3-fluorophenyl)methyl]-5-iodoindole-2-carboxylic acid.
| Compound Name | 1-[(3-fluorophenyl)methyl]-5-iodoindole-2-carboxylic acid |
|---|---|
| PubChem CID | 66850442 |
| Molecular Formula | C16H11FINO2 |
| Molecular Weight | 395.17 g/mol |
| Exact Mass | 394.98 |
| IUPAC Name | 1-[(3-fluorophenyl)methyl]-5-iodoindole-2-carboxylic acid |
| SMILES | O=C(O)c1cc2cc(I)ccc2n1Cc1cccc(F)c1 |
| InChI | InChI=1S/C16H11FINO2/c17-12-3-1-2-10(6-12)9-19-14-5-4-13(18)7-11(14)8-15(19)16(20)21/h1-8H,9H2,(H,20,21) |
| InChIKey | VPMLBSRWCNKMGW-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.17 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|