C23H16F2N4O2 — CID 66846286
5-fluoro-1-[(3-fluorophenyl)methyl]-N-(7-hydroxypyrrolo[2,3-b]pyridin-5-yl)indole-2-carboxamide (PubChem CID 66846286) has the molecular formula C23H16F2N4O2 and a molecular weight of 418.40 g/mol. Its IUPAC name is 5-fluoro-1-[(3-fluorophenyl)methyl]-N-(7-hydroxypyrrolo[2,3-b]pyridin-5-yl)indole-2-carboxamide.
| Compound Name | 5-fluoro-1-[(3-fluorophenyl)methyl]-N-(7-hydroxypyrrolo[2,3-b]pyridin-5-yl)indole-2-carboxamide |
|---|---|
| PubChem CID | 66846286 |
| Molecular Formula | C23H16F2N4O2 |
| Molecular Weight | 418.40 g/mol |
| Exact Mass | 418.12 |
| IUPAC Name | 5-fluoro-1-[(3-fluorophenyl)methyl]-N-(7-hydroxypyrrolo[2,3-b]pyridin-5-yl)indole-2-carboxamide |
| SMILES | O=C(Nc1cc2ccnc-2n(O)c1)c1cc2cc(F)ccc2n1Cc1cccc(F)c1 |
| InChI | InChI=1S/C23H16F2N4O2/c24-17-3-1-2-14(8-17)12-28-20-5-4-18(25)9-16(20)11-21(28)23(30)27-19-10-15-6-7-26-22(15)29(31)13-19/h1-11,13,31H,12H2,(H,27,30) |
| InChIKey | PZQZGXBTZLLQOV-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 72.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.40 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|