C25H19F2N5O — CID 25182888
5-fluoro-1-[(3-fluorophenyl)methyl]-N-(2,7,10-triazatricyclo[6.4.0.02,6]dodeca-1(12),3,5,7-tetraen-3-yl)indole-2-carboxamide (PubChem CID 25182888) has the molecular formula C25H19F2N5O and a molecular weight of 443.46 g/mol. Its IUPAC name is 5-fluoro-1-[(3-fluorophenyl)methyl]-N-(2,7,10-triazatricyclo[6.4.0.02,6]dodeca-1(12),3,5,7-tetraen-3-yl)indole-2-carboxamide.
| Compound Name | 5-fluoro-1-[(3-fluorophenyl)methyl]-N-(2,7,10-triazatricyclo[6.4.0.02,6]dodeca-1(12),3,5,7-tetraen-3-yl)indole-2-carboxamide |
|---|---|
| PubChem CID | 25182888 |
| Molecular Formula | C25H19F2N5O |
| Molecular Weight | 443.46 g/mol |
| Exact Mass | 443.16 |
| IUPAC Name | 5-fluoro-1-[(3-fluorophenyl)methyl]-N-(2,7,10-triazatricyclo[6.4.0.02,6]dodeca-1(12),3,5,7-tetraen-3-yl)indole-2-carboxamide |
| SMILES | O=C(Nc1ccc2nc3c(n12)=CCNC3)c1cc2cc(F)ccc2n1Cc1cccc(F)c1 |
| InChI | InChI=1S/C25H19F2N5O/c26-17-3-1-2-15(10-17)14-31-20-5-4-18(27)11-16(20)12-22(31)25(33)30-24-7-6-23-29-19-13-28-9-8-21(19)32(23)24/h1-8,10-12,28H,9,13-14H2,(H,30,33) |
| InChIKey | FXKJJEFSZJWVAB-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 63.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.46 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |