C31H25F2N5O — CID 25182729
5-fluoro-1-[(3-fluorophenyl)methyl]-N-(12-phenyl-2,7,12-triazatricyclo[6.4.0.02,6]dodeca-1(8),4,6-trien-5-yl)indole-2-carboxamide (PubChem CID 25182729) has the molecular formula C31H25F2N5O and a molecular weight of 521.57 g/mol. Its IUPAC name is 5-fluoro-1-[(3-fluorophenyl)methyl]-N-(12-phenyl-2,7,12-triazatricyclo[6.4.0.02,6]dodeca-1(8),4,6-trien-5-yl)indole-2-carboxamide.
| Compound Name | 5-fluoro-1-[(3-fluorophenyl)methyl]-N-(12-phenyl-2,7,12-triazatricyclo[6.4.0.02,6]dodeca-1(8),4,6-trien-5-yl)indole-2-carboxamide |
|---|---|
| PubChem CID | 25182729 |
| Molecular Formula | C31H25F2N5O |
| Molecular Weight | 521.57 g/mol |
| Exact Mass | 521.20 |
| IUPAC Name | 5-fluoro-1-[(3-fluorophenyl)methyl]-N-(12-phenyl-2,7,12-triazatricyclo[6.4.0.02,6]dodeca-1(8),4,6-trien-5-yl)indole-2-carboxamide |
| SMILES | O=C(NC1=CCn2c1nc1c2N(c2ccccc2)CCC1)c1cc2cc(F)ccc2n1Cc1cccc(F)c1 |
| InChI | InChI=1S/C31H25F2N5O/c32-22-7-4-6-20(16-22)19-38-27-12-11-23(33)17-21(27)18-28(38)30(39)35-25-13-15-37-29(25)34-26-10-5-14-36(31(26)37)24-8-2-1-3-9-24/h1-4,6-9,11-13,16-18H,5,10,14-15,19H2,(H,35,39) |
| InChIKey | MAMXPVXCUYDFKT-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 55.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.57 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |