C27H26FN5O — CID 25183484
6-ethyl-1-[(3-fluorophenyl)methyl]-N-(2,7,12-triazatricyclo[6.4.0.02,6]dodeca-1(8),4,6-trien-5-yl)indole-2-carboxamide (PubChem CID 25183484) has the molecular formula C27H26FN5O and a molecular weight of 455.54 g/mol. Its IUPAC name is 6-ethyl-1-[(3-fluorophenyl)methyl]-N-(2,7,12-triazatricyclo[6.4.0.02,6]dodeca-1(8),4,6-trien-5-yl)indole-2-carboxamide.
| Compound Name | 6-ethyl-1-[(3-fluorophenyl)methyl]-N-(2,7,12-triazatricyclo[6.4.0.02,6]dodeca-1(8),4,6-trien-5-yl)indole-2-carboxamide |
|---|---|
| PubChem CID | 25183484 |
| Molecular Formula | C27H26FN5O |
| Molecular Weight | 455.54 g/mol |
| Exact Mass | 455.21 |
| IUPAC Name | 6-ethyl-1-[(3-fluorophenyl)methyl]-N-(2,7,12-triazatricyclo[6.4.0.02,6]dodeca-1(8),4,6-trien-5-yl)indole-2-carboxamide |
| SMILES | CCc1ccc2cc(C(=O)NC3=CCn4c3nc3c4NCCC3)n(Cc3cccc(F)c3)c2c1 |
| InChI | InChI=1S/C27H26FN5O/c1-2-17-8-9-19-15-24(33(23(19)14-17)16-18-5-3-6-20(28)13-18)27(34)31-22-10-12-32-25-21(30-26(22)32)7-4-11-29-25/h3,5-6,8-10,13-15,29H,2,4,7,11-12,16H2,1H3,(H,31,34) |
| InChIKey | KKESZBCWDNVYBE-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 63.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.54 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |