C25H21F2N5O — CID 25183053
5-fluoro-1-[(3-fluorophenyl)methyl]-N-(7,8,12-triazatricyclo[6.4.0.02,6]dodeca-1,3,5-trien-5-yl)indole-2-carboxamide (PubChem CID 25183053) has the molecular formula C25H21F2N5O and a molecular weight of 445.47 g/mol. Its IUPAC name is 5-fluoro-1-[(3-fluorophenyl)methyl]-N-(7,8,12-triazatricyclo[6.4.0.02,6]dodeca-1,3,5-trien-5-yl)indole-2-carboxamide.
| Compound Name | 5-fluoro-1-[(3-fluorophenyl)methyl]-N-(7,8,12-triazatricyclo[6.4.0.02,6]dodeca-1,3,5-trien-5-yl)indole-2-carboxamide |
|---|---|
| PubChem CID | 25183053 |
| Molecular Formula | C25H21F2N5O |
| Molecular Weight | 445.47 g/mol |
| Exact Mass | 445.17 |
| IUPAC Name | 5-fluoro-1-[(3-fluorophenyl)methyl]-N-(7,8,12-triazatricyclo[6.4.0.02,6]dodeca-1,3,5-trien-5-yl)indole-2-carboxamide |
| SMILES | O=C(Nc1ccc2c3n([nH]c1-2)CCCN3)c1cc2cc(F)ccc2n1Cc1cccc(F)c1 |
| InChI | InChI=1S/C25H21F2N5O/c26-17-4-1-3-15(11-17)14-31-21-8-5-18(27)12-16(21)13-22(31)25(33)29-20-7-6-19-23(20)30-32-10-2-9-28-24(19)32/h1,3-8,11-13,28,30H,2,9-10,14H2,(H,29,33) |
| InChIKey | RWZYANYWQUPQTL-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 66.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.47 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |