C25H20F2N6O2 — CID 25182726
5-fluoro-1-[(3-fluorophenyl)methyl]-N-(6-oxo-1,3,8,11-tetrazatricyclo[7.4.0.02,7]trideca-2(7),8,12-trien-11-yl)indole-2-carboxamide (PubChem CID 25182726) has the molecular formula C25H20F2N6O2 and a molecular weight of 474.47 g/mol. Its IUPAC name is 5-fluoro-1-[(3-fluorophenyl)methyl]-N-(6-oxo-1,3,8,11-tetrazatricyclo[7.4.0.02,7]trideca-2(7),8,12-trien-11-yl)indole-2-carboxamide.
| Compound Name | 5-fluoro-1-[(3-fluorophenyl)methyl]-N-(6-oxo-1,3,8,11-tetrazatricyclo[7.4.0.02,7]trideca-2(7),8,12-trien-11-yl)indole-2-carboxamide |
|---|---|
| PubChem CID | 25182726 |
| Molecular Formula | C25H20F2N6O2 |
| Molecular Weight | 474.47 g/mol |
| Exact Mass | 474.16 |
| IUPAC Name | 5-fluoro-1-[(3-fluorophenyl)methyl]-N-(6-oxo-1,3,8,11-tetrazatricyclo[7.4.0.02,7]trideca-2(7),8,12-trien-11-yl)indole-2-carboxamide |
| SMILES | O=C1CCNc2c1nc1n2C=CN(NC(=O)c2cc3cc(F)ccc3n2Cc2cccc(F)c2)C1 |
| InChI | InChI=1S/C25H20F2N6O2/c26-17-3-1-2-15(10-17)13-33-19-5-4-18(27)11-16(19)12-20(33)25(35)30-31-8-9-32-22(14-31)29-23-21(34)6-7-28-24(23)32/h1-5,8-12,28H,6-7,13-14H2,(H,30,35) |
| InChIKey | NGTFJCRUGOOCJV-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 84.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.47 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |