C25H20F2N6O2 — CID 66905088
5-fluoro-1-[(3-fluorophenyl)methyl]-3-(6-oxo-1,3,8,11-tetrazatricyclo[7.4.0.02,7]trideca-2(7),8,12-trien-11-yl)indole-2-carboxamide (PubChem CID 66905088) has the molecular formula C25H20F2N6O2 and a molecular weight of 474.47 g/mol. Its IUPAC name is 5-fluoro-1-[(3-fluorophenyl)methyl]-3-(6-oxo-1,3,8,11-tetrazatricyclo[7.4.0.02,7]trideca-2(7),8,12-trien-11-yl)indole-2-carboxamide.
| Compound Name | 5-fluoro-1-[(3-fluorophenyl)methyl]-3-(6-oxo-1,3,8,11-tetrazatricyclo[7.4.0.02,7]trideca-2(7),8,12-trien-11-yl)indole-2-carboxamide |
|---|---|
| PubChem CID | 66905088 |
| Molecular Formula | C25H20F2N6O2 |
| Molecular Weight | 474.47 g/mol |
| Exact Mass | 474.16 |
| IUPAC Name | 5-fluoro-1-[(3-fluorophenyl)methyl]-3-(6-oxo-1,3,8,11-tetrazatricyclo[7.4.0.02,7]trideca-2(7),8,12-trien-11-yl)indole-2-carboxamide |
| SMILES | NC(=O)c1c(N2C=Cn3c(nc4c3NCCC4=O)C2)c2cc(F)ccc2n1Cc1cccc(F)c1 |
| InChI | InChI=1S/C25H20F2N6O2/c26-15-3-1-2-14(10-15)12-33-18-5-4-16(27)11-17(18)22(23(33)24(28)35)31-8-9-32-20(13-31)30-21-19(34)6-7-29-25(21)32/h1-5,8-11,29H,6-7,12-13H2,(H2,28,35) |
| InChIKey | JHKPGIRIIBYVIJ-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 98.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.47 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |