C17H13ClFNO3 — CID 146173969
methyl 1-[(4-chlorophenyl)methyl]-5-fluoro-3-hydroxyindole-2-carboxylate (PubChem CID 146173969) has the molecular formula C17H13ClFNO3 and a molecular weight of 333.75 g/mol. Its IUPAC name is methyl 1-[(4-chlorophenyl)methyl]-5-fluoro-3-hydroxyindole-2-carboxylate.
| Compound Name | methyl 1-[(4-chlorophenyl)methyl]-5-fluoro-3-hydroxyindole-2-carboxylate |
|---|---|
| PubChem CID | 146173969 |
| Molecular Formula | C17H13ClFNO3 |
| Molecular Weight | 333.75 g/mol |
| Exact Mass | 333.06 |
| IUPAC Name | methyl 1-[(4-chlorophenyl)methyl]-5-fluoro-3-hydroxyindole-2-carboxylate |
| SMILES | COC(=O)c1c(O)c2cc(F)ccc2n1Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H13ClFNO3/c1-23-17(22)15-16(21)13-8-12(19)6-7-14(13)20(15)9-10-2-4-11(18)5-3-10/h2-8,21H,9H2,1H3 |
| InChIKey | RMBMLUMAIJKLSK-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 51.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.75 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |