About dimethyl 1-[(4-chlorophenyl)methyl]-4-hydroxy-6-oxopyridine-2,3-dicarboxylate
dimethyl 1-[(4-chlorophenyl)methyl]-4-hydroxy-6-oxopyridine-2,3-dicarboxylate (PubChem CID 177492677) has the molecular formula C16H14ClNO6
and a molecular weight of 351.74 g/mol. Its IUPAC name is dimethyl 1-[(4-chlorophenyl)methyl]-4-hydroxy-6-oxopyridine-2,3-dicarboxylate.
Molecular Properties
| Compound Name | dimethyl 1-[(4-chlorophenyl)methyl]-4-hydroxy-6-oxopyridine-2,3-dicarboxylate |
| PubChem CID | 177492677 |
| Molecular Formula | C16H14ClNO6 |
| Molecular Weight | 351.74 g/mol |
| Exact Mass | 351.05 |
| IUPAC Name | dimethyl 1-[(4-chlorophenyl)methyl]-4-hydroxy-6-oxopyridine-2,3-dicarboxylate |
| SMILES | COC(=O)c1c(O)cc(=O)n(Cc2ccc(Cl)cc2)c1C(=O)OC |
| InChI | InChI=1S/C16H14ClNO6/c1-23-15(21)13-11(19)7-12(20)18(14(13)16(22)24-2)8-9-3-5-10(17)6-4-9/h3-7,19H,8H2,1-2H3 |
| InChIKey | AEHSHZCDQDUBSC-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 351.74 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze dimethyl 1-[(4-chlorophenyl)methyl]-4-hydroxy-6-oxopyridine-2,3-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl 1-[(4-chlorophenyl)methyl]-4-hydroxy-6-oxopyridine-2,3-dicarboxylate?
The IUPAC name of dimethyl 1-[(4-chlorophenyl)methyl]-4-hydroxy-6-oxopyridine-2,3-dicarboxylate (CID 177492677) is dimethyl 1-[(4-chlorophenyl)methyl]-4-hydroxy-6-oxopyridine-2,3-dicarboxylate.
What is the SMILES notation for dimethyl 1-[(4-chlorophenyl)methyl]-4-hydroxy-6-oxopyridine-2,3-dicarboxylate?
The canonical SMILES for dimethyl 1-[(4-chlorophenyl)methyl]-4-hydroxy-6-oxopyridine-2,3-dicarboxylate is COC(=O)c1c(O)cc(=O)n(Cc2ccc(Cl)cc2)c1C(=O)OC.
What is the InChIKey of dimethyl 1-[(4-chlorophenyl)methyl]-4-hydroxy-6-oxopyridine-2,3-dicarboxylate?
The InChIKey is AEHSHZCDQDUBSC-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14ClNO6/c1-23-15(21)13-11(19)7-12(20)18(14(13)16(22)24-2)8-9-3-5-10(17)6-4-9/h3-7,19H,8H2,1-2H3.
What are the key properties of dimethyl 1-[(4-chlorophenyl)methyl]-4-hydroxy-6-oxopyridine-2,3-dicarboxylate?
dimethyl 1-[(4-chlorophenyl)methyl]-4-hydroxy-6-oxopyridine-2,3-dicarboxylate has a molecular weight of 351.74 g/mol, XLogP of 1.83, 4 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl 1-[(4-chlorophenyl)methyl]-4-hydroxy-6-oxopyridine-2,3-dicarboxylate is sourced from PubChem (CID 177492677), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).