C14H11NO6 — CID 135032453
1-benzyl-4-hydroxy-6-oxopyridine-2,3-dicarboxylic acid (PubChem CID 135032453) has the molecular formula C14H11NO6 and a molecular weight of 289.24 g/mol. Its IUPAC name is 1-benzyl-4-hydroxy-6-oxopyridine-2,3-dicarboxylic acid.
| Compound Name | 1-benzyl-4-hydroxy-6-oxopyridine-2,3-dicarboxylic acid |
|---|---|
| PubChem CID | 135032453 |
| Molecular Formula | C14H11NO6 |
| Molecular Weight | 289.24 g/mol |
| Exact Mass | 289.06 |
| IUPAC Name | 1-benzyl-4-hydroxy-6-oxopyridine-2,3-dicarboxylic acid |
| SMILES | O=C(O)c1c(O)cc(=O)n(Cc2ccccc2)c1C(=O)O |
| InChI | InChI=1S/C14H11NO6/c16-9-6-10(17)15(7-8-4-2-1-3-5-8)12(14(20)21)11(9)13(18)19/h1-6,16H,7H2,(H,18,19)(H,20,21) |
| InChIKey | GKOSLHDHLWFECZ-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 116.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.24 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |