C22H27NO6 — CID 135032454
ditert-butyl 1-benzyl-4-hydroxy-6-oxopyridine-2,3-dicarboxylate (PubChem CID 135032454) has the molecular formula C22H27NO6 and a molecular weight of 401.46 g/mol. Its IUPAC name is ditert-butyl 1-benzyl-4-hydroxy-6-oxopyridine-2,3-dicarboxylate.
| Compound Name | ditert-butyl 1-benzyl-4-hydroxy-6-oxopyridine-2,3-dicarboxylate |
|---|---|
| PubChem CID | 135032454 |
| Molecular Formula | C22H27NO6 |
| Molecular Weight | 401.46 g/mol |
| Exact Mass | 401.18 |
| IUPAC Name | ditert-butyl 1-benzyl-4-hydroxy-6-oxopyridine-2,3-dicarboxylate |
| SMILES | CC(C)(C)OC(=O)c1c(O)cc(=O)n(Cc2ccccc2)c1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C22H27NO6/c1-21(2,3)28-19(26)17-15(24)12-16(25)23(13-14-10-8-7-9-11-14)18(17)20(27)29-22(4,5)6/h7-12,24H,13H2,1-6H3 |
| InChIKey | BWLIVPHYZZFCAU-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.46 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |