C18H16ClNO7 — CID 56934553
trimethyl 1-[(2-chlorophenyl)methyl]-6-oxopyridine-2,3,4-tricarboxylate (PubChem CID 56934553) has the molecular formula C18H16ClNO7 and a molecular weight of 393.78 g/mol. Its IUPAC name is trimethyl 1-[(2-chlorophenyl)methyl]-6-oxopyridine-2,3,4-tricarboxylate.
| Compound Name | trimethyl 1-[(2-chlorophenyl)methyl]-6-oxopyridine-2,3,4-tricarboxylate |
|---|---|
| PubChem CID | 56934553 |
| Molecular Formula | C18H16ClNO7 |
| Molecular Weight | 393.78 g/mol |
| Exact Mass | 393.06 |
| IUPAC Name | trimethyl 1-[(2-chlorophenyl)methyl]-6-oxopyridine-2,3,4-tricarboxylate |
| SMILES | COC(=O)c1cc(=O)n(Cc2ccccc2Cl)c(C(=O)OC)c1C(=O)OC |
| InChI | InChI=1S/C18H16ClNO7/c1-25-16(22)11-8-13(21)20(9-10-6-4-5-7-12(10)19)15(18(24)27-3)14(11)17(23)26-2/h4-8H,9H2,1-3H3 |
| InChIKey | UDZZTXSGZRINHT-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 100.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.78 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|