About methyl 3-[1-[(4-chlorophenyl)methyl]-5-fluoroindol-2-yl]-2,2-dimethylpropanoate
methyl 3-[1-[(4-chlorophenyl)methyl]-5-fluoroindol-2-yl]-2,2-dimethylpropanoate (PubChem CID 14914445) has the molecular formula C21H21ClFNO2
and a molecular weight of 373.86 g/mol. Its IUPAC name is methyl 3-[1-[(4-chlorophenyl)methyl]-5-fluoroindol-2-yl]-2,2-dimethylpropanoate.
Molecular Properties
| Compound Name | methyl 3-[1-[(4-chlorophenyl)methyl]-5-fluoroindol-2-yl]-2,2-dimethylpropanoate |
| PubChem CID | 14914445 |
| Molecular Formula | C21H21ClFNO2 |
| Molecular Weight | 373.86 g/mol |
| Exact Mass | 373.12 |
| IUPAC Name | methyl 3-[1-[(4-chlorophenyl)methyl]-5-fluoroindol-2-yl]-2,2-dimethylpropanoate |
| SMILES | COC(=O)C(C)(C)Cc1cc2cc(F)ccc2n1Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H21ClFNO2/c1-21(2,20(25)26-3)12-18-11-15-10-17(23)8-9-19(15)24(18)13-14-4-6-16(22)7-5-14/h4-11H,12-13H2,1-3H3 |
| InChIKey | RUOHAVDLXZDISR-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 373.86 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze methyl 3-[1-[(4-chlorophenyl)methyl]-5-fluoroindol-2-yl]-2,2-dimethylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-[1-[(4-chlorophenyl)methyl]-5-fluoroindol-2-yl]-2,2-dimethylpropanoate?
The IUPAC name of methyl 3-[1-[(4-chlorophenyl)methyl]-5-fluoroindol-2-yl]-2,2-dimethylpropanoate (CID 14914445) is methyl 3-[1-[(4-chlorophenyl)methyl]-5-fluoroindol-2-yl]-2,2-dimethylpropanoate.
What is the SMILES notation for methyl 3-[1-[(4-chlorophenyl)methyl]-5-fluoroindol-2-yl]-2,2-dimethylpropanoate?
The canonical SMILES for methyl 3-[1-[(4-chlorophenyl)methyl]-5-fluoroindol-2-yl]-2,2-dimethylpropanoate is COC(=O)C(C)(C)Cc1cc2cc(F)ccc2n1Cc1ccc(Cl)cc1.
What is the InChIKey of methyl 3-[1-[(4-chlorophenyl)methyl]-5-fluoroindol-2-yl]-2,2-dimethylpropanoate?
The InChIKey is RUOHAVDLXZDISR-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H21ClFNO2/c1-21(2,20(25)26-3)12-18-11-15-10-17(23)8-9-19(15)24(18)13-14-4-6-16(22)7-5-14/h4-11H,12-13H2,1-3H3.
What are the key properties of methyl 3-[1-[(4-chlorophenyl)methyl]-5-fluoroindol-2-yl]-2,2-dimethylpropanoate?
methyl 3-[1-[(4-chlorophenyl)methyl]-5-fluoroindol-2-yl]-2,2-dimethylpropanoate has a molecular weight of 373.86 g/mol, XLogP of 5.22, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-[1-[(4-chlorophenyl)methyl]-5-fluoroindol-2-yl]-2,2-dimethylpropanoate is sourced from PubChem (CID 14914445), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).