C27H25Cl2NO6 — CID 146173905
methyl 5-chloro-1-[(4-chlorophenyl)methyl]-3-[4-(2-methoxyethoxymethoxy)phenoxy]indole-2-carboxylate (PubChem CID 146173905) has the molecular formula C27H25Cl2NO6 and a molecular weight of 530.40 g/mol. Its IUPAC name is methyl 5-chloro-1-[(4-chlorophenyl)methyl]-3-[4-(2-methoxyethoxymethoxy)phenoxy]indole-2-carboxylate.
| Compound Name | methyl 5-chloro-1-[(4-chlorophenyl)methyl]-3-[4-(2-methoxyethoxymethoxy)phenoxy]indole-2-carboxylate |
|---|---|
| PubChem CID | 146173905 |
| Molecular Formula | C27H25Cl2NO6 |
| Molecular Weight | 530.40 g/mol |
| Exact Mass | 529.11 |
| IUPAC Name | methyl 5-chloro-1-[(4-chlorophenyl)methyl]-3-[4-(2-methoxyethoxymethoxy)phenoxy]indole-2-carboxylate |
| SMILES | COCCOCOc1ccc(Oc2c(C(=O)OC)n(Cc3ccc(Cl)cc3)c3ccc(Cl)cc23)cc1 |
| InChI | InChI=1S/C27H25Cl2NO6/c1-32-13-14-34-17-35-21-8-10-22(11-9-21)36-26-23-15-20(29)7-12-24(23)30(25(26)27(31)33-2)16-18-3-5-19(28)6-4-18/h3-12,15H,13-14,16-17H2,1-2H3 |
| InChIKey | PUAXEOPKTFWBHF-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 68.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.40 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|