C19H15ClN2O5 — CID 175044351
dimethyl 1-[4-(4-chlorophenoxy)phenyl]imidazole-4,5-dicarboxylate (PubChem CID 175044351) has the molecular formula C19H15ClN2O5 and a molecular weight of 386.79 g/mol. Its IUPAC name is dimethyl 1-[4-(4-chlorophenoxy)phenyl]imidazole-4,5-dicarboxylate.
| Compound Name | dimethyl 1-[4-(4-chlorophenoxy)phenyl]imidazole-4,5-dicarboxylate |
|---|---|
| PubChem CID | 175044351 |
| Molecular Formula | C19H15ClN2O5 |
| Molecular Weight | 386.79 g/mol |
| Exact Mass | 386.07 |
| IUPAC Name | dimethyl 1-[4-(4-chlorophenoxy)phenyl]imidazole-4,5-dicarboxylate |
| SMILES | COC(=O)c1ncn(-c2ccc(Oc3ccc(Cl)cc3)cc2)c1C(=O)OC |
| InChI | InChI=1S/C19H15ClN2O5/c1-25-18(23)16-17(19(24)26-2)22(11-21-16)13-5-9-15(10-6-13)27-14-7-3-12(20)4-8-14/h3-11H,1-2H3 |
| InChIKey | FIZICMMKLUJHPJ-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 79.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.79 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |