C10H16N2O4 — CID 143864925
dimethyl 1-methylimidazole-4,5-dicarboxylate;ethane (PubChem CID 143864925) has the molecular formula C10H16N2O4 and a molecular weight of 228.25 g/mol. Its IUPAC name is dimethyl 1-methylimidazole-4,5-dicarboxylate;ethane.
| Compound Name | dimethyl 1-methylimidazole-4,5-dicarboxylate;ethane |
|---|---|
| PubChem CID | 143864925 |
| Molecular Formula | C10H16N2O4 |
| Molecular Weight | 228.25 g/mol |
| Exact Mass | 228.11 |
| IUPAC Name | dimethyl 1-methylimidazole-4,5-dicarboxylate;ethane |
| SMILES | CC.COC(=O)c1ncn(C)c1C(=O)OC |
| InChI | InChI=1S/C8H10N2O4.C2H6/c1-10-4-9-5(7(11)13-2)6(10)8(12)14-3;1-2/h4H,1-3H3;1-2H3 |
| InChIKey | GHIIBNASZHNTQN-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 70.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.25 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |