C12H20N4O3 — CID 103546039
methyl 5-amino-1-[3-(tert-butylamino)-3-oxopropyl]imidazole-4-carboxylate (PubChem CID 103546039) has the molecular formula C12H20N4O3 and a molecular weight of 268.32 g/mol. Its IUPAC name is methyl 5-amino-1-[3-(tert-butylamino)-3-oxopropyl]imidazole-4-carboxylate.
| Compound Name | methyl 5-amino-1-[3-(tert-butylamino)-3-oxopropyl]imidazole-4-carboxylate |
|---|---|
| PubChem CID | 103546039 |
| Molecular Formula | C12H20N4O3 |
| Molecular Weight | 268.32 g/mol |
| Exact Mass | 268.15 |
| IUPAC Name | methyl 5-amino-1-[3-(tert-butylamino)-3-oxopropyl]imidazole-4-carboxylate |
| SMILES | COC(=O)c1ncn(CCC(=O)NC(C)(C)C)c1N |
| InChI | InChI=1S/C12H20N4O3/c1-12(2,3)15-8(17)5-6-16-7-14-9(10(16)13)11(18)19-4/h7H,5-6,13H2,1-4H3,(H,15,17) |
| InChIKey | SVFNXXXLFQSZBS-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 99.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.32 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |