C9H13F2N3O3 — CID 114128436
methyl 5-amino-1-[2-(2,2-difluoroethoxy)ethyl]imidazole-4-carboxylate (PubChem CID 114128436) has the molecular formula C9H13F2N3O3 and a molecular weight of 249.22 g/mol. Its IUPAC name is methyl 5-amino-1-[2-(2,2-difluoroethoxy)ethyl]imidazole-4-carboxylate.
| Compound Name | methyl 5-amino-1-[2-(2,2-difluoroethoxy)ethyl]imidazole-4-carboxylate |
|---|---|
| PubChem CID | 114128436 |
| Molecular Formula | C9H13F2N3O3 |
| Molecular Weight | 249.22 g/mol |
| Exact Mass | 249.09 |
| IUPAC Name | methyl 5-amino-1-[2-(2,2-difluoroethoxy)ethyl]imidazole-4-carboxylate |
| SMILES | COC(=O)c1ncn(CCOCC(F)F)c1N |
| InChI | InChI=1S/C9H13F2N3O3/c1-16-9(15)7-8(12)14(5-13-7)2-3-17-4-6(10)11/h5-6H,2-4,12H2,1H3 |
| InChIKey | INDCMEIIIVTZCJ-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.22 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|