About methylazanium;methyl 5-hydroxy-1-methylimidazole-4-carboxylate
methylazanium;methyl 5-hydroxy-1-methylimidazole-4-carboxylate (PubChem CID 160833833) has the molecular formula C7H14N3O3+
and a molecular weight of 188.21 g/mol. Its IUPAC name is methylazanium;methyl 5-hydroxy-1-methylimidazole-4-carboxylate.
Molecular Properties
| Compound Name | methylazanium;methyl 5-hydroxy-1-methylimidazole-4-carboxylate |
| PubChem CID | 160833833 |
| Molecular Formula | C7H14N3O3+ |
| Molecular Weight | 188.21 g/mol |
| Exact Mass | 188.10 |
| IUPAC Name | methylazanium;methyl 5-hydroxy-1-methylimidazole-4-carboxylate |
| SMILES | COC(=O)c1ncn(C)c1O.C[NH3+] |
| InChI | InChI=1S/C6H8N2O3.CH5N/c1-8-3-7-4(5(8)9)6(10)11-2;1-2/h3,9H,1-2H3;2H2,1H3/p+1 |
| InChIKey | SHDOSYLKJANPRS-UHFFFAOYSA-O |
| XLogP | -1.23 |
| TPSA | 91.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.21 |
| LogP ≤ 5 | -1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methylazanium;methyl 5-hydroxy-1-methylimidazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methylazanium;methyl 5-hydroxy-1-methylimidazole-4-carboxylate?
The IUPAC name of methylazanium;methyl 5-hydroxy-1-methylimidazole-4-carboxylate (CID 160833833) is methylazanium;methyl 5-hydroxy-1-methylimidazole-4-carboxylate.
What is the SMILES notation for methylazanium;methyl 5-hydroxy-1-methylimidazole-4-carboxylate?
The canonical SMILES for methylazanium;methyl 5-hydroxy-1-methylimidazole-4-carboxylate is COC(=O)c1ncn(C)c1O.C[NH3+].
What is the InChIKey of methylazanium;methyl 5-hydroxy-1-methylimidazole-4-carboxylate?
The InChIKey is SHDOSYLKJANPRS-UHFFFAOYSA-O. The full InChI is InChI=1S/C6H8N2O3.CH5N/c1-8-3-7-4(5(8)9)6(10)11-2;1-2/h3,9H,1-2H3;2H2,1H3/p+1.
What are the key properties of methylazanium;methyl 5-hydroxy-1-methylimidazole-4-carboxylate?
methylazanium;methyl 5-hydroxy-1-methylimidazole-4-carboxylate has a molecular weight of 188.21 g/mol, XLogP of -1.23, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methylazanium;methyl 5-hydroxy-1-methylimidazole-4-carboxylate is sourced from PubChem (CID 160833833), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).