C4H6N2O2 — CID 91420197
1-methylimidazole-4,5-diol (PubChem CID 91420197) has the molecular formula C4H6N2O2 and a molecular weight of 114.10 g/mol. Its IUPAC name is 1-methylimidazole-4,5-diol.
| Compound Name | 1-methylimidazole-4,5-diol |
|---|---|
| PubChem CID | 91420197 |
| Molecular Formula | C4H6N2O2 |
| Molecular Weight | 114.10 g/mol |
| Exact Mass | 114.04 |
| IUPAC Name | 1-methylimidazole-4,5-diol |
| SMILES | Cn1cnc(O)c1O |
| InChI | InChI=1S/C4H6N2O2/c1-6-2-5-3(7)4(6)8/h2,7-8H,1H3 |
| InChIKey | BDCXQZVBBZDAEZ-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 114.10 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |