C12H16N2O6 — CID 58928819
1-O-tert-butyl 4-O,5-O-dimethyl imidazole-1,4,5-tricarboxylate (PubChem CID 58928819) has the molecular formula C12H16N2O6 and a molecular weight of 284.27 g/mol. Its IUPAC name is 1-O-tert-butyl 4-O,5-O-dimethyl imidazole-1,4,5-tricarboxylate.
| Compound Name | 1-O-tert-butyl 4-O,5-O-dimethyl imidazole-1,4,5-tricarboxylate |
|---|---|
| PubChem CID | 58928819 |
| Molecular Formula | C12H16N2O6 |
| Molecular Weight | 284.27 g/mol |
| Exact Mass | 284.10 |
| IUPAC Name | 1-O-tert-butyl 4-O,5-O-dimethyl imidazole-1,4,5-tricarboxylate |
| SMILES | COC(=O)c1ncn(C(=O)OC(C)(C)C)c1C(=O)OC |
| InChI | InChI=1S/C12H16N2O6/c1-12(2,3)20-11(17)14-6-13-7(9(15)18-4)8(14)10(16)19-5/h6H,1-5H3 |
| InChIKey | HRFCIMHHFJAPCE-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 96.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.27 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|