C16H21NO6 — CID 71762424
1-O-tert-butyl 3-O-methyl 2-(3-methoxy-3-oxoprop-1-en-2-yl)-4-methylpyrrole-1,3-dicarboxylate (PubChem CID 71762424) has the molecular formula C16H21NO6 and a molecular weight of 323.35 g/mol. Its IUPAC name is 1-O-tert-butyl 3-O-methyl 2-(3-methoxy-3-oxoprop-1-en-2-yl)-4-methylpyrrole-1,3-dicarboxylate.
| Compound Name | 1-O-tert-butyl 3-O-methyl 2-(3-methoxy-3-oxoprop-1-en-2-yl)-4-methylpyrrole-1,3-dicarboxylate |
|---|---|
| PubChem CID | 71762424 |
| Molecular Formula | C16H21NO6 |
| Molecular Weight | 323.35 g/mol |
| Exact Mass | 323.14 |
| IUPAC Name | 1-O-tert-butyl 3-O-methyl 2-(3-methoxy-3-oxoprop-1-en-2-yl)-4-methylpyrrole-1,3-dicarboxylate |
| SMILES | C=C(C(=O)OC)c1c(C(=O)OC)c(C)cn1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H21NO6/c1-9-8-17(15(20)23-16(3,4)5)12(10(2)13(18)21-6)11(9)14(19)22-7/h8H,2H2,1,3-7H3 |
| InChIKey | YRVPLOZCFPFKSV-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 83.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.35 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|