C12H17NO3 — CID 86586103
tert-butyl 2-formyl-3,4-dimethylpyrrole-1-carboxylate (PubChem CID 86586103) has the molecular formula C12H17NO3 and a molecular weight of 223.27 g/mol. Its IUPAC name is tert-butyl 2-formyl-3,4-dimethylpyrrole-1-carboxylate.
| Compound Name | tert-butyl 2-formyl-3,4-dimethylpyrrole-1-carboxylate |
|---|---|
| PubChem CID | 86586103 |
| Molecular Formula | C12H17NO3 |
| Molecular Weight | 223.27 g/mol |
| Exact Mass | 223.12 |
| IUPAC Name | tert-butyl 2-formyl-3,4-dimethylpyrrole-1-carboxylate |
| SMILES | Cc1cn(C(=O)OC(C)(C)C)c(C=O)c1C |
| InChI | InChI=1S/C12H17NO3/c1-8-6-13(10(7-14)9(8)2)11(15)16-12(3,4)5/h6-7H,1-5H3 |
| InChIKey | AIVOYFQVTNBARM-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 48.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.27 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|