About tert-butyl 2-formyl-3-isocyanatopyrrole-1-carboxylate;hydrate
tert-butyl 2-formyl-3-isocyanatopyrrole-1-carboxylate;hydrate (PubChem CID 174249184) has the molecular formula C11H14N2O5
and a molecular weight of 254.24 g/mol. Its IUPAC name is tert-butyl 2-formyl-3-isocyanatopyrrole-1-carboxylate;hydrate.
Molecular Properties
| Compound Name | tert-butyl 2-formyl-3-isocyanatopyrrole-1-carboxylate;hydrate |
| PubChem CID | 174249184 |
| Molecular Formula | C11H14N2O5 |
| Molecular Weight | 254.24 g/mol |
| Exact Mass | 254.09 |
| IUPAC Name | tert-butyl 2-formyl-3-isocyanatopyrrole-1-carboxylate;hydrate |
| SMILES | CC(C)(C)OC(=O)n1ccc(N=C=O)c1C=O.O |
| InChI | InChI=1S/C11H12N2O4.H2O/c1-11(2,3)17-10(16)13-5-4-8(12-7-15)9(13)6-14;/h4-6H,1-3H3;1H2 |
| InChIKey | AVSRTMOENONYSU-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 109.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.24 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl 2-formyl-3-isocyanatopyrrole-1-carboxylate;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 2-formyl-3-isocyanatopyrrole-1-carboxylate;hydrate?
The IUPAC name of tert-butyl 2-formyl-3-isocyanatopyrrole-1-carboxylate;hydrate (CID 174249184) is tert-butyl 2-formyl-3-isocyanatopyrrole-1-carboxylate;hydrate.
What is the SMILES notation for tert-butyl 2-formyl-3-isocyanatopyrrole-1-carboxylate;hydrate?
The canonical SMILES for tert-butyl 2-formyl-3-isocyanatopyrrole-1-carboxylate;hydrate is CC(C)(C)OC(=O)n1ccc(N=C=O)c1C=O.O.
What is the InChIKey of tert-butyl 2-formyl-3-isocyanatopyrrole-1-carboxylate;hydrate?
The InChIKey is AVSRTMOENONYSU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12N2O4.H2O/c1-11(2,3)17-10(16)13-5-4-8(12-7-15)9(13)6-14;/h4-6H,1-3H3;1H2.
What are the key properties of tert-butyl 2-formyl-3-isocyanatopyrrole-1-carboxylate;hydrate?
tert-butyl 2-formyl-3-isocyanatopyrrole-1-carboxylate;hydrate has a molecular weight of 254.24 g/mol, XLogP of 1.23, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 2-formyl-3-isocyanatopyrrole-1-carboxylate;hydrate is sourced from PubChem (CID 174249184), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).