C14H16FNO2 — CID 45103063
tert-butyl 6-fluoro-3-methylindole-1-carboxylate (PubChem CID 45103063) has the molecular formula C14H16FNO2 and a molecular weight of 249.28 g/mol. Its IUPAC name is tert-butyl 6-fluoro-3-methylindole-1-carboxylate.
| Compound Name | tert-butyl 6-fluoro-3-methylindole-1-carboxylate |
|---|---|
| PubChem CID | 45103063 |
| Molecular Formula | C14H16FNO2 |
| Molecular Weight | 249.28 g/mol |
| Exact Mass | 249.12 |
| IUPAC Name | tert-butyl 6-fluoro-3-methylindole-1-carboxylate |
| SMILES | Cc1cn(C(=O)OC(C)(C)C)c2cc(F)ccc12 |
| InChI | InChI=1S/C14H16FNO2/c1-9-8-16(13(17)18-14(2,3)4)12-7-10(15)5-6-11(9)12/h5-8H,1-4H3 |
| InChIKey | BJZUDNRMUXEVJW-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.28 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |