C17H20F3NO3S — CID 163918963
tert-butyl 3-(1-methylsulfanyloxyethyl)-6-(trifluoromethyl)indole-1-carboxylate (PubChem CID 163918963) has the molecular formula C17H20F3NO3S and a molecular weight of 375.41 g/mol. Its IUPAC name is tert-butyl 3-(1-methylsulfanyloxyethyl)-6-(trifluoromethyl)indole-1-carboxylate.
| Compound Name | tert-butyl 3-(1-methylsulfanyloxyethyl)-6-(trifluoromethyl)indole-1-carboxylate |
|---|---|
| PubChem CID | 163918963 |
| Molecular Formula | C17H20F3NO3S |
| Molecular Weight | 375.41 g/mol |
| Exact Mass | 375.11 |
| IUPAC Name | tert-butyl 3-(1-methylsulfanyloxyethyl)-6-(trifluoromethyl)indole-1-carboxylate |
| SMILES | CSOC(C)c1cn(C(=O)OC(C)(C)C)c2cc(C(F)(F)F)ccc12 |
| InChI | InChI=1S/C17H20F3NO3S/c1-10(24-25-5)13-9-21(15(22)23-16(2,3)4)14-8-11(17(18,19)20)6-7-12(13)14/h6-10H,1-5H3 |
| InChIKey | QYSZACLKCQQQAM-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 40.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.41 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|