C16H14Br2F3NO2 — CID 169499999
tert-butyl 4-bromo-2-[2-bromo-5-(trifluoromethyl)phenyl]pyrrole-1-carboxylate (PubChem CID 169499999) has the molecular formula C16H14Br2F3NO2 and a molecular weight of 469.10 g/mol. Its IUPAC name is tert-butyl 4-bromo-2-[2-bromo-5-(trifluoromethyl)phenyl]pyrrole-1-carboxylate.
| Compound Name | tert-butyl 4-bromo-2-[2-bromo-5-(trifluoromethyl)phenyl]pyrrole-1-carboxylate |
|---|---|
| PubChem CID | 169499999 |
| Molecular Formula | C16H14Br2F3NO2 |
| Molecular Weight | 469.10 g/mol |
| Exact Mass | 466.93 |
| IUPAC Name | tert-butyl 4-bromo-2-[2-bromo-5-(trifluoromethyl)phenyl]pyrrole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)n1cc(Br)cc1-c1cc(C(F)(F)F)ccc1Br |
| InChI | InChI=1S/C16H14Br2F3NO2/c1-15(2,3)24-14(23)22-8-10(17)7-13(22)11-6-9(16(19,20)21)4-5-12(11)18/h4-8H,1-3H3 |
| InChIKey | ATBCKZYLEJREQX-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.10 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |