C15H14BrF2NO2 — CID 169499919
tert-butyl 4-bromo-2-(2,3-difluorophenyl)pyrrole-1-carboxylate (PubChem CID 169499919) has the molecular formula C15H14BrF2NO2 and a molecular weight of 358.18 g/mol. Its IUPAC name is tert-butyl 4-bromo-2-(2,3-difluorophenyl)pyrrole-1-carboxylate.
| Compound Name | tert-butyl 4-bromo-2-(2,3-difluorophenyl)pyrrole-1-carboxylate |
|---|---|
| PubChem CID | 169499919 |
| Molecular Formula | C15H14BrF2NO2 |
| Molecular Weight | 358.18 g/mol |
| Exact Mass | 357.02 |
| IUPAC Name | tert-butyl 4-bromo-2-(2,3-difluorophenyl)pyrrole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)n1cc(Br)cc1-c1cccc(F)c1F |
| InChI | InChI=1S/C15H14BrF2NO2/c1-15(2,3)21-14(20)19-8-9(16)7-12(19)10-5-4-6-11(17)13(10)18/h4-8H,1-3H3 |
| InChIKey | JYPOXCVBBBEKQM-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.18 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |