C19H19NO2 — CID 15851800
tert-butyl 2-naphthalen-1-ylpyrrole-1-carboxylate (PubChem CID 15851800) has the molecular formula C19H19NO2 and a molecular weight of 293.37 g/mol. Its IUPAC name is tert-butyl 2-naphthalen-1-ylpyrrole-1-carboxylate.
| Compound Name | tert-butyl 2-naphthalen-1-ylpyrrole-1-carboxylate |
|---|---|
| PubChem CID | 15851800 |
| Molecular Formula | C19H19NO2 |
| Molecular Weight | 293.37 g/mol |
| Exact Mass | 293.14 |
| IUPAC Name | tert-butyl 2-naphthalen-1-ylpyrrole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)n1cccc1-c1cccc2ccccc12 |
| InChI | InChI=1S/C19H19NO2/c1-19(2,3)22-18(21)20-13-7-12-17(20)16-11-6-9-14-8-4-5-10-15(14)16/h4-13H,1-3H3 |
| InChIKey | NNPKULCAOGNTID-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.37 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |