C22H27NO3 — CID 71740402
tert-butyl 2-[1-(1-benzofuran-2-yl)-3-methylbutyl]pyrrole-1-carboxylate (PubChem CID 71740402) has the molecular formula C22H27NO3 and a molecular weight of 353.46 g/mol. Its IUPAC name is tert-butyl 2-[1-(1-benzofuran-2-yl)-3-methylbutyl]pyrrole-1-carboxylate.
| Compound Name | tert-butyl 2-[1-(1-benzofuran-2-yl)-3-methylbutyl]pyrrole-1-carboxylate |
|---|---|
| PubChem CID | 71740402 |
| Molecular Formula | C22H27NO3 |
| Molecular Weight | 353.46 g/mol |
| Exact Mass | 353.20 |
| IUPAC Name | tert-butyl 2-[1-(1-benzofuran-2-yl)-3-methylbutyl]pyrrole-1-carboxylate |
| SMILES | CC(C)CC(c1cc2ccccc2o1)c1cccn1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C22H27NO3/c1-15(2)13-17(20-14-16-9-6-7-11-19(16)25-20)18-10-8-12-23(18)21(24)26-22(3,4)5/h6-12,14-15,17H,13H2,1-5H3 |
| InChIKey | UBVRRNRDKUKKKU-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 44.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.46 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |