C14H25NO3Si — CID 53242898
tert-butyl 2-(1-hydroxy-2-trimethylsilylethyl)pyrrole-1-carboxylate (PubChem CID 53242898) has the molecular formula C14H25NO3Si and a molecular weight of 283.44 g/mol. Its IUPAC name is tert-butyl 2-(1-hydroxy-2-trimethylsilylethyl)pyrrole-1-carboxylate.
| Compound Name | tert-butyl 2-(1-hydroxy-2-trimethylsilylethyl)pyrrole-1-carboxylate |
|---|---|
| PubChem CID | 53242898 |
| Molecular Formula | C14H25NO3Si |
| Molecular Weight | 283.44 g/mol |
| Exact Mass | 283.16 |
| IUPAC Name | tert-butyl 2-(1-hydroxy-2-trimethylsilylethyl)pyrrole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)n1cccc1C(O)C[Si](C)(C)C |
| InChI | InChI=1S/C14H25NO3Si/c1-14(2,3)18-13(17)15-9-7-8-11(15)12(16)10-19(4,5)6/h7-9,12,16H,10H2,1-6H3 |
| InChIKey | JDAASAZDBFJNMG-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 51.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.44 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|