C13H15NO2S — CID 15851801
tert-butyl 2-thiophen-2-ylpyrrole-1-carboxylate (PubChem CID 15851801) has the molecular formula C13H15NO2S and a molecular weight of 249.34 g/mol. Its IUPAC name is tert-butyl 2-thiophen-2-ylpyrrole-1-carboxylate.
| Compound Name | tert-butyl 2-thiophen-2-ylpyrrole-1-carboxylate |
|---|---|
| PubChem CID | 15851801 |
| Molecular Formula | C13H15NO2S |
| Molecular Weight | 249.34 g/mol |
| Exact Mass | 249.08 |
| IUPAC Name | tert-butyl 2-thiophen-2-ylpyrrole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)n1cccc1-c1cccs1 |
| InChI | InChI=1S/C13H15NO2S/c1-13(2,3)16-12(15)14-8-4-6-10(14)11-7-5-9-17-11/h4-9H,1-3H3 |
| InChIKey | MDIHSTZFNSPRTD-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.34 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |