C19H27NO2SSi — CID 102328142
tert-butyl 3-prop-1-en-2-yl-5-thiophen-2-yl-2-trimethylsilylpyrrole-1-carboxylate (PubChem CID 102328142) has the molecular formula C19H27NO2SSi and a molecular weight of 361.58 g/mol. Its IUPAC name is tert-butyl 3-prop-1-en-2-yl-5-thiophen-2-yl-2-trimethylsilylpyrrole-1-carboxylate.
| Compound Name | tert-butyl 3-prop-1-en-2-yl-5-thiophen-2-yl-2-trimethylsilylpyrrole-1-carboxylate |
|---|---|
| PubChem CID | 102328142 |
| Molecular Formula | C19H27NO2SSi |
| Molecular Weight | 361.58 g/mol |
| Exact Mass | 361.15 |
| IUPAC Name | tert-butyl 3-prop-1-en-2-yl-5-thiophen-2-yl-2-trimethylsilylpyrrole-1-carboxylate |
| SMILES | C=C(C)c1cc(-c2cccs2)n(C(=O)OC(C)(C)C)c1[Si](C)(C)C |
| InChI | InChI=1S/C19H27NO2SSi/c1-13(2)14-12-15(16-10-9-11-23-16)20(17(14)24(6,7)8)18(21)22-19(3,4)5/h9-12H,1H2,2-8H3 |
| InChIKey | IUQLPMWXJGIFHI-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.58 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|