C14H19N3O2S — CID 42685560
tert-butyl 4-amino-5-ethyl-3-thiophen-2-ylpyrazole-1-carboxylate (PubChem CID 42685560) has the molecular formula C14H19N3O2S and a molecular weight of 293.39 g/mol. Its IUPAC name is tert-butyl 4-amino-5-ethyl-3-thiophen-2-ylpyrazole-1-carboxylate.
| Compound Name | tert-butyl 4-amino-5-ethyl-3-thiophen-2-ylpyrazole-1-carboxylate |
|---|---|
| PubChem CID | 42685560 |
| Molecular Formula | C14H19N3O2S |
| Molecular Weight | 293.39 g/mol |
| Exact Mass | 293.12 |
| IUPAC Name | tert-butyl 4-amino-5-ethyl-3-thiophen-2-ylpyrazole-1-carboxylate |
| SMILES | CCc1c(N)c(-c2cccs2)nn1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C14H19N3O2S/c1-5-9-11(15)12(10-7-6-8-20-10)16-17(9)13(18)19-14(2,3)4/h6-8H,5,15H2,1-4H3 |
| InChIKey | VBNBGSQFAGGOJN-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 70.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.39 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |